C21H22FN3O5S — CID 24540685
N-(3-ethoxypropyl)-6-[(4-fluorophenyl)sulfamoyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 24540685) has the molecular formula C21H22FN3O5S and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-6-[(4-fluorophenyl)sulfamoyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-(3-ethoxypropyl)-6-[(4-fluorophenyl)sulfamoyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 24540685 |
| Molecular Formula | C21H22FN3O5S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-(3-ethoxypropyl)-6-[(4-fluorophenyl)sulfamoyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | CCOCCCNC(=O)c1cc(=O)[nH]c2ccc(S(=O)(=O)Nc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C21H22FN3O5S/c1-2-30-11-3-10-23-21(27)18-13-20(26)24-19-9-8-16(12-17(18)19)31(28,29)25-15-6-4-14(22)5-7-15/h4-9,12-13,25H,2-3,10-11H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | BIBDMEBDNYOLOP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|