C17H12FIN2O4 — CID 55512401
[3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55512401) has the molecular formula C17H12FIN2O4 and a molecular weight of 454.20 g/mol. Its IUPAC name is [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55512401 |
| Molecular Formula | C17H12FIN2O4 |
| Molecular Weight | 454.20 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | [3-(3-fluoro-4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(-c2noc(COC(=O)/C=C/c3ccc(I)o3)n2)cc1F |
| InChI | InChI=1S/C17H12FIN2O4/c1-10-2-3-11(8-13(10)18)17-20-15(25-21-17)9-23-16(22)7-5-12-4-6-14(19)24-12/h2-8H,9H2,1H3/b7-5+ |
| InChIKey | AMTOCXSCGQGLAE-FNORWQNLSA-N |
| XLogP | 4.14 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.20 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|