C16H13F3N4OS — CID 55520984
N-(2-cyanoethyl)-N-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 55520984) has the molecular formula C16H13F3N4OS and a molecular weight of 366.37 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(2-cyanoethyl)-N-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55520984 |
| Molecular Formula | C16H13F3N4OS |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-(2-cyanoethyl)-N-phenyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | N#CCCN(C(=O)CSc1nccc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C16H13F3N4OS/c17-16(18,19)13-7-9-21-15(22-13)25-11-14(24)23(10-4-8-20)12-5-2-1-3-6-12/h1-3,5-7,9H,4,10-11H2 |
| InChIKey | RELTTWVYKHACBE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |