C23H39N3O3 — CID 55521489
N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]adamantane-1-carboxamide (PubChem CID 55521489) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]adamantane-1-carboxamide.
| Compound Name | N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 55521489 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | N-[2-[(4-methyl-2-morpholin-4-ylpentyl)amino]-2-oxoethyl]adamantane-1-carboxamide |
| SMILES | CC(C)CC(CNC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)N1CCOCC1 |
| InChI | InChI=1S/C23H39N3O3/c1-16(2)7-20(26-3-5-29-6-4-26)14-24-21(27)15-25-22(28)23-11-17-8-18(12-23)10-19(9-17)13-23/h16-20H,3-15H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | CCUDELXKZRCTEG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |