C16H24N4O5S2 — CID 55526803
N,N-diethyl-4-[2-(4-nitrophenyl)sulfanylacetyl]piperazine-1-sulfonamide (PubChem CID 55526803) has the molecular formula C16H24N4O5S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(4-nitrophenyl)sulfanylacetyl]piperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-4-[2-(4-nitrophenyl)sulfanylacetyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 55526803 |
| Molecular Formula | C16H24N4O5S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N,N-diethyl-4-[2-(4-nitrophenyl)sulfanylacetyl]piperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(C(=O)CSc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C16H24N4O5S2/c1-3-18(4-2)27(24,25)19-11-9-17(10-12-19)16(21)13-26-15-7-5-14(6-8-15)20(22)23/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | SHAUCVFBOFZOQU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 104.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|