About pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate
pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate (PubChem CID 55527991) has the molecular formula C14H13BrN2O4S
and a molecular weight of 385.24 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate |
| PubChem CID | 55527991 |
| Molecular Formula | C14H13BrN2O4S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate |
| SMILES | O=C(CNS(=O)(=O)c1cccc(Br)c1)OCc1ccccn1 |
| InChI | InChI=1S/C14H13BrN2O4S/c15-11-4-3-6-13(8-11)22(19,20)17-9-14(18)21-10-12-5-1-2-7-16-12/h1-8,17H,9-10H2 |
| InChIKey | VZNWAVMLOIPSBE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate?
The IUPAC name of pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate (CID 55527991) is pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate.
What is the SMILES notation for pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate?
The canonical SMILES for pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate is O=C(CNS(=O)(=O)c1cccc(Br)c1)OCc1ccccn1.
What is the InChIKey of pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate?
The InChIKey is VZNWAVMLOIPSBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrN2O4S/c15-11-4-3-6-13(8-11)22(19,20)17-9-14(18)21-10-12-5-1-2-7-16-12/h1-8,17H,9-10H2.
What are the key properties of pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate?
pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate has a molecular weight of 385.24 g/mol, XLogP of 1.87, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethyl 2-[(3-bromophenyl)sulfonylamino]acetate is sourced from PubChem (CID 55527991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).