C22H22N4O3S — CID 55537547
N-(2-benzylpyrazol-3-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide (PubChem CID 55537547) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is N-(2-benzylpyrazol-3-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide.
| Compound Name | N-(2-benzylpyrazol-3-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55537547 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | N-(2-benzylpyrazol-3-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(N2CCCS2(=O)=O)cc1)Nc1ccnn1Cc1ccccc1 |
| InChI | InChI=1S/C22H22N4O3S/c27-22(24-21-13-14-23-25(21)17-19-5-2-1-3-6-19)12-9-18-7-10-20(11-8-18)26-15-4-16-30(26,28)29/h1-3,5-14H,4,15-17H2,(H,24,27) |
| InChIKey | UZEFLNNULTZAHM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|