C25H28N2O4 — CID 55537984
N-[4-[[4-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-2-oxochromen-7-yl]acetamide (PubChem CID 55537984) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[4-[[4-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-2-oxochromen-7-yl]acetamide.
| Compound Name | N-[4-[[4-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-2-oxochromen-7-yl]acetamide |
|---|---|
| PubChem CID | 55537984 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[4-[[4-[2-(4-hydroxyphenyl)ethyl]piperidin-1-yl]methyl]-2-oxochromen-7-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(CN3CCC(CCc4ccc(O)cc4)CC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C25H28N2O4/c1-17(28)26-21-6-9-23-20(14-25(30)31-24(23)15-21)16-27-12-10-19(11-13-27)3-2-18-4-7-22(29)8-5-18/h4-9,14-15,19,29H,2-3,10-13,16H2,1H3,(H,26,28) |
| InChIKey | CGCBURVDCPTZMJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|