C25H21F2N3O2S — CID 55540095
N-[4-[N-(1,3-benzothiazol-2-yl)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 55540095) has the molecular formula C25H21F2N3O2S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[4-[N-(1,3-benzothiazol-2-yl)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-[N-(1,3-benzothiazol-2-yl)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 55540095 |
| Molecular Formula | C25H21F2N3O2S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[4-[N-(1,3-benzothiazol-2-yl)-2-methylanilino]-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | Cc1ccccc1N(C(=O)CCCNC(=O)c1ccc(F)cc1F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C25H21F2N3O2S/c1-16-7-2-4-9-21(16)30(25-29-20-8-3-5-10-22(20)33-25)23(31)11-6-14-28-24(32)18-13-12-17(26)15-19(18)27/h2-5,7-10,12-13,15H,6,11,14H2,1H3,(H,28,32) |
| InChIKey | PFYRCAKDBCIKQY-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|