C19H18N2O6S — CID 55542601
(4-methoxy-2-nitrophenyl) 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 55542601) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-methoxy-2-nitrophenyl) 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55542601 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CC(=O)N(c3ccc(SC)cc3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N2O6S/c1-26-14-5-8-17(16(10-14)21(24)25)27-19(23)12-9-18(22)20(11-12)13-3-6-15(28-2)7-4-13/h3-8,10,12H,9,11H2,1-2H3 |
| InChIKey | HTSKMYWSPKSHFD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|