C20H17F3N2O6 — CID 55754547
(4-methoxy-2-nitrophenyl) 5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylate (PubChem CID 55754547) has the molecular formula C20H17F3N2O6 and a molecular weight of 438.36 g/mol. Its IUPAC name is (4-methoxy-2-nitrophenyl) 5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylate.
| Compound Name | (4-methoxy-2-nitrophenyl) 5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55754547 |
| Molecular Formula | C20H17F3N2O6 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | (4-methoxy-2-nitrophenyl) 5-oxo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylate |
| SMILES | COc1ccc(OC(=O)C2CC(=O)N(Cc3cccc(C(F)(F)F)c3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17F3N2O6/c1-30-15-5-6-17(16(9-15)25(28)29)31-19(27)13-8-18(26)24(11-13)10-12-3-2-4-14(7-12)20(21,22)23/h2-7,9,13H,8,10-11H2,1H3 |
| InChIKey | QMDSWBRICQLTFU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|