C15H22N4O5S — CID 55542636
N'-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]-2-phenoxyethanimidamide (PubChem CID 55542636) has the molecular formula C15H22N4O5S and a molecular weight of 370.43 g/mol. Its IUPAC name is N'-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]-2-phenoxyethanimidamide.
| Compound Name | N'-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]-2-phenoxyethanimidamide |
|---|---|
| PubChem CID | 55542636 |
| Molecular Formula | C15H22N4O5S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N'-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethoxy]-2-phenoxyethanimidamide |
| SMILES | CS(=O)(=O)N1CCN(C(=O)CO/N=C(/N)COc2ccccc2)CC1 |
| InChI | InChI=1S/C15H22N4O5S/c1-25(21,22)19-9-7-18(8-10-19)15(20)12-24-17-14(16)11-23-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H2,16,17) |
| InChIKey | XJXKRKHQHGDGMA-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|