C21H21N5O4 — CID 55547797
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1H-indazol-7-yl)butanamide (PubChem CID 55547797) has the molecular formula C21H21N5O4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1H-indazol-7-yl)butanamide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1H-indazol-7-yl)butanamide |
|---|---|
| PubChem CID | 55547797 |
| Molecular Formula | C21H21N5O4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1H-indazol-7-yl)butanamide |
| SMILES | COc1cc2ncn(CCCC(=O)Nc3cccc4cn[nH]c34)c(=O)c2cc1OC |
| InChI | InChI=1S/C21H21N5O4/c1-29-17-9-14-16(10-18(17)30-2)22-12-26(21(14)28)8-4-7-19(27)24-15-6-3-5-13-11-23-25-20(13)15/h3,5-6,9-12H,4,7-8H2,1-2H3,(H,23,25)(H,24,27) |
| InChIKey | PSWXJDHMGFPRJO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |