C24H30N4O3S2 — CID 55554934
N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 55554934) has the molecular formula C24H30N4O3S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55554934 |
| Molecular Formula | C24H30N4O3S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C24H30N4O3S2/c1-24(2,3)20-16-21(28(26-20)17-18-8-5-4-6-9-18)25-23(29)19-11-13-27(14-12-19)33(30,31)22-10-7-15-32-22/h4-10,15-16,19H,11-14,17H2,1-3H3,(H,25,29) |
| InChIKey | OJVQOKVSGPJOOB-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |