C25H30ClN5O — CID 55687718
N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide (PubChem CID 55687718) has the molecular formula C25H30ClN5O and a molecular weight of 452.00 g/mol. Its IUPAC name is N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55687718 |
| Molecular Formula | C25H30ClN5O |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(5-chloro-2-pyridinyl)piperidine-4-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C2CCN(c3ccc(Cl)cn3)CC2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H30ClN5O/c1-25(2,3)21-15-23(31(29-21)17-18-7-5-4-6-8-18)28-24(32)19-11-13-30(14-12-19)22-10-9-20(26)16-27-22/h4-10,15-16,19H,11-14,17H2,1-3H3,(H,28,32) |
| InChIKey | NVBDAGKLLWLKHW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |