C25H30N4O2S — CID 55556615
N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide (PubChem CID 55556615) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55556615 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-(1-benzyl-3-tert-butylpyrazol-5-yl)-1-(thiophene-2-carbonyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1cc(NC(=O)C2CCCN(C(=O)c3cccs3)C2)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C25H30N4O2S/c1-25(2,3)21-15-22(29(27-21)16-18-9-5-4-6-10-18)26-23(30)19-11-7-13-28(17-19)24(31)20-12-8-14-32-20/h4-6,8-10,12,14-15,19H,7,11,13,16-17H2,1-3H3,(H,26,30) |
| InChIKey | KRMIQRYGNFWOQG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |