C22H19F3N6O2 — CID 55555287
N'-(3-ethyl-4-oxoquinazolin-2-yl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide (PubChem CID 55555287) has the molecular formula C22H19F3N6O2 and a molecular weight of 456.43 g/mol. Its IUPAC name is N'-(3-ethyl-4-oxoquinazolin-2-yl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide.
| Compound Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55555287 |
| Molecular Formula | C22H19F3N6O2 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N'-(3-ethyl-4-oxoquinazolin-2-yl)-5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbohydrazide |
| SMILES | CCn1c(NNC(=O)c2cnn(-c3cccc(C(F)(F)F)c3)c2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H19F3N6O2/c1-3-30-20(33)16-9-4-5-10-18(16)27-21(30)29-28-19(32)17-12-26-31(13(17)2)15-8-6-7-14(11-15)22(23,24)25/h4-12H,3H2,1-2H3,(H,27,29)(H,28,32) |
| InChIKey | XWSWPNQNOREGKU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|