C21H31N3O5S — CID 55556878
(3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate (PubChem CID 55556878) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate.
| Compound Name | (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55556878 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (3-tert-butyl-1,2,4-oxadiazol-5-yl)methyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCC(=O)OCc2nc(C(C)(C)C)no2)c(C)c1C |
| InChI | InChI=1S/C21H31N3O5S/c1-12-13(2)15(4)19(16(5)14(12)3)30(26,27)22-10-9-18(25)28-11-17-23-20(24-29-17)21(6,7)8/h22H,9-11H2,1-8H3 |
| InChIKey | NHWJPBWNBGCZNP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |