C23H31NO6S2 — CID 55821584
3-(benzenesulfonyl)propyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate (PubChem CID 55821584) has the molecular formula C23H31NO6S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 3-(benzenesulfonyl)propyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate.
| Compound Name | 3-(benzenesulfonyl)propyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55821584 |
| Molecular Formula | C23H31NO6S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 3-(benzenesulfonyl)propyl 3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NCCC(=O)OCCCS(=O)(=O)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C23H31NO6S2/c1-16-17(2)19(4)23(20(5)18(16)3)32(28,29)24-13-12-22(25)30-14-9-15-31(26,27)21-10-7-6-8-11-21/h6-8,10-11,24H,9,12-15H2,1-5H3 |
| InChIKey | TVVFRIZKVRZNCC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|