C20H28ClNO5 — CID 55561058
methyl 1-[(4-butoxy-3-chloro-5-ethoxybenzoyl)amino]cyclopentane-1-carboxylate (PubChem CID 55561058) has the molecular formula C20H28ClNO5 and a molecular weight of 397.90 g/mol. Its IUPAC name is methyl 1-[(4-butoxy-3-chloro-5-ethoxybenzoyl)amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[(4-butoxy-3-chloro-5-ethoxybenzoyl)amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 55561058 |
| Molecular Formula | C20H28ClNO5 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | methyl 1-[(4-butoxy-3-chloro-5-ethoxybenzoyl)amino]cyclopentane-1-carboxylate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NC2(C(=O)OC)CCCC2)cc1OCC |
| InChI | InChI=1S/C20H28ClNO5/c1-4-6-11-27-17-15(21)12-14(13-16(17)26-5-2)18(23)22-20(19(24)25-3)9-7-8-10-20/h12-13H,4-11H2,1-3H3,(H,22,23) |
| InChIKey | ALGHRTGDFXLMGM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|