C18H25ClN2O4 — CID 55768059
3-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-4,5-dimethoxybenzamide (PubChem CID 55768059) has the molecular formula C18H25ClN2O4 and a molecular weight of 368.86 g/mol. Its IUPAC name is 3-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 55768059 |
| Molecular Formula | C18H25ClN2O4 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-4,5-dimethoxybenzamide |
| SMILES | CCNC(=O)C1(NC(=O)c2cc(Cl)c(OC)c(OC)c2)CCCCC1 |
| InChI | InChI=1S/C18H25ClN2O4/c1-4-20-17(23)18(8-6-5-7-9-18)21-16(22)12-10-13(19)15(25-3)14(11-12)24-2/h10-11H,4-9H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | OYOUPDLZUIVPGI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |