C14H18ClNO4 — CID 66005162
3-chloro-N-[(3-hydroxycyclobutyl)methyl]-4,5-dimethoxybenzamide (PubChem CID 66005162) has the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. Its IUPAC name is 3-chloro-N-[(3-hydroxycyclobutyl)methyl]-4,5-dimethoxybenzamide.
| Compound Name | 3-chloro-N-[(3-hydroxycyclobutyl)methyl]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 66005162 |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3-chloro-N-[(3-hydroxycyclobutyl)methyl]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC2CC(O)C2)cc(Cl)c1OC |
| InChI | InChI=1S/C14H18ClNO4/c1-19-12-6-9(5-11(15)13(12)20-2)14(18)16-7-8-3-10(17)4-8/h5-6,8,10,17H,3-4,7H2,1-2H3,(H,16,18) |
| InChIKey | DPPYKGCJINNCBE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |