C20H28ClN3O5S — CID 55768184
4-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 55768184) has the molecular formula C20H28ClN3O5S and a molecular weight of 457.98 g/mol. Its IUPAC name is 4-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55768184 |
| Molecular Formula | C20H28ClN3O5S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 4-chloro-N-[1-(ethylcarbamoyl)cyclohexyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CCNC(=O)C1(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)CCCCC1 |
| InChI | InChI=1S/C20H28ClN3O5S/c1-2-22-19(26)20(8-4-3-5-9-20)23-18(25)15-6-7-16(21)17(14-15)30(27,28)24-10-12-29-13-11-24/h6-7,14H,2-5,8-13H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | FKTXIOWANKXFIP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |