C19H22FN3O5S — CID 55564425
[2-(4-fluorophenyl)morpholin-4-yl]-(4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)methanone (PubChem CID 55564425) has the molecular formula C19H22FN3O5S and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-(4-fluorophenyl)morpholin-4-yl]-(4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)methanone.
| Compound Name | [2-(4-fluorophenyl)morpholin-4-yl]-(4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 55564425 |
| Molecular Formula | C19H22FN3O5S |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [2-(4-fluorophenyl)morpholin-4-yl]-(4-morpholin-4-ylsulfonyl-1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1cc(S(=O)(=O)N2CCOCC2)c[nH]1)N1CCOC(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H22FN3O5S/c20-15-3-1-14(2-4-15)18-13-22(5-10-28-18)19(24)17-11-16(12-21-17)29(25,26)23-6-8-27-9-7-23/h1-4,11-12,18,21H,5-10,13H2 |
| InChIKey | NETFAFXESVGZFA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |