C24H25N7O5 — CID 55568713
1,3-dimethyl-2,4-dioxo-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)pyrido[2,3-d]pyrimidine-7-carbohydrazide (PubChem CID 55568713) has the molecular formula C24H25N7O5 and a molecular weight of 491.51 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)pyrido[2,3-d]pyrimidine-7-carbohydrazide.
| Compound Name | 1,3-dimethyl-2,4-dioxo-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)pyrido[2,3-d]pyrimidine-7-carbohydrazide |
|---|---|
| PubChem CID | 55568713 |
| Molecular Formula | C24H25N7O5 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-N'-(4-oxo-3-pentylphthalazine-1-carbonyl)pyrido[2,3-d]pyrimidine-7-carbohydrazide |
| SMILES | CCCCCn1nc(C(=O)NNC(=O)c2ccc3c(=O)n(C)c(=O)n(C)c3n2)c2ccccc2c1=O |
| InChI | InChI=1S/C24H25N7O5/c1-4-5-8-13-31-23(35)15-10-7-6-9-14(15)18(28-31)21(33)27-26-20(32)17-12-11-16-19(25-17)29(2)24(36)30(3)22(16)34/h6-7,9-12H,4-5,8,13H2,1-3H3,(H,26,32)(H,27,33) |
| InChIKey | SETOBCRYZWQYEW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|