C16H19ClN4 — CID 55570136
6-chloro-4-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine (PubChem CID 55570136) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is 6-chloro-4-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-chloro-4-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 55570136 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 6-chloro-4-N-[(1-phenylcyclopentyl)methyl]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(Cl)cc(NCC2(c3ccccc3)CCCC2)n1 |
| InChI | InChI=1S/C16H19ClN4/c17-13-10-14(21-15(18)20-13)19-11-16(8-4-5-9-16)12-6-2-1-3-7-12/h1-3,6-7,10H,4-5,8-9,11H2,(H3,18,19,20,21) |
| InChIKey | WAJBGADVHIPCHI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |