C17H18INO4 — CID 55577746
N-[(2,4-dimethoxyphenyl)methyl]-2-(4-iodophenoxy)acetamide (PubChem CID 55577746) has the molecular formula C17H18INO4 and a molecular weight of 427.24 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-2-(4-iodophenoxy)acetamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-2-(4-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 55577746 |
| Molecular Formula | C17H18INO4 |
| Molecular Weight | 427.24 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-2-(4-iodophenoxy)acetamide |
| SMILES | COc1ccc(CNC(=O)COc2ccc(I)cc2)c(OC)c1 |
| InChI | InChI=1S/C17H18INO4/c1-21-15-6-3-12(16(9-15)22-2)10-19-17(20)11-23-14-7-4-13(18)5-8-14/h3-9H,10-11H2,1-2H3,(H,19,20) |
| InChIKey | SXJGIRQLBAKEIW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|