C18H26N6O2S3 — CID 55578416
3-tert-butyl-5-[1-[[5-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,2,4-oxadiazole (PubChem CID 55578416) has the molecular formula C18H26N6O2S3 and a molecular weight of 454.65 g/mol. Its IUPAC name is 3-tert-butyl-5-[1-[[5-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,2,4-oxadiazole.
| Compound Name | 3-tert-butyl-5-[1-[[5-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 55578416 |
| Molecular Formula | C18H26N6O2S3 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 3-tert-butyl-5-[1-[[5-[1-(3-tert-butyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,2,4-oxadiazole |
| SMILES | CC(Sc1nnc(SC(C)c2nc(C(C)(C)C)no2)s1)c1nc(C(C)(C)C)no1 |
| InChI | InChI=1S/C18H26N6O2S3/c1-9(11-19-13(23-25-11)17(3,4)5)27-15-21-22-16(29-15)28-10(2)12-20-14(24-26-12)18(6,7)8/h9-10H,1-8H3 |
| InChIKey | JPLOOVLFEIVXGW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |