C18H22N4O6S — CID 55578752
3-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-nitrophenyl)propanamide (PubChem CID 55578752) has the molecular formula C18H22N4O6S and a molecular weight of 422.46 g/mol. Its IUPAC name is 3-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-nitrophenyl)propanamide.
| Compound Name | 3-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55578752 |
| Molecular Formula | C18H22N4O6S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 3-[5-(diethylsulfamoyl)-2-oxo-1-pyridinyl]-N-(2-nitrophenyl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(=O)n(CCC(=O)Nc2ccccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N4O6S/c1-3-21(4-2)29(27,28)14-9-10-18(24)20(13-14)12-11-17(23)19-15-7-5-6-8-16(15)22(25)26/h5-10,13H,3-4,11-12H2,1-2H3,(H,19,23) |
| InChIKey | RZOKHAHHOLGIGZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 131.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|