C22H28N6O3S — CID 55578796
4-(4-cyano-2-pyridinyl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]piperazine-1-carboxamide (PubChem CID 55578796) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-(4-cyano-2-pyridinyl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-cyano-2-pyridinyl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55578796 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-(4-cyano-2-pyridinyl)-N-[[4-(diethylsulfamoyl)phenyl]methyl]piperazine-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CNC(=O)N2CCN(c3cc(C#N)ccn3)CC2)cc1 |
| InChI | InChI=1S/C22H28N6O3S/c1-3-28(4-2)32(30,31)20-7-5-18(6-8-20)17-25-22(29)27-13-11-26(12-14-27)21-15-19(16-23)9-10-24-21/h5-10,15H,3-4,11-14,17H2,1-2H3,(H,25,29) |
| InChIKey | OYCYPPLHLHGFRY-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |