C18H17ClF3NO — CID 55579324
N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 55579324) has the molecular formula C18H17ClF3NO and a molecular weight of 355.79 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55579324 |
| Molecular Formula | C18H17ClF3NO |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethyl]-N-methyl-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(c1cccc(Cl)c1)N(C)C(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17ClF3NO/c1-12(14-6-4-8-16(19)11-14)23(2)17(24)10-13-5-3-7-15(9-13)18(20,21)22/h3-9,11-12H,10H2,1-2H3 |
| InChIKey | QQVDBEWGSWAKJI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |