C17H13F3N4O3S — CID 55580632
5-methyl-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]-4-nitrothiophene-2-carboxamide (PubChem CID 55580632) has the molecular formula C17H13F3N4O3S and a molecular weight of 410.38 g/mol. Its IUPAC name is 5-methyl-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]-4-nitrothiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55580632 |
| Molecular Formula | C17H13F3N4O3S |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | 5-methyl-N-[5-methyl-2-[3-(trifluoromethyl)phenyl]pyrazol-3-yl]-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cc([N+](=O)[O-])c(C)s2)n(-c2cccc(C(F)(F)F)c2)n1 |
| InChI | InChI=1S/C17H13F3N4O3S/c1-9-6-15(21-16(25)14-8-13(24(26)27)10(2)28-14)23(22-9)12-5-3-4-11(7-12)17(18,19)20/h3-8H,1-2H3,(H,21,25) |
| InChIKey | RAKRCBLSORFSHB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|