C26H28N6O3 — CID 55581049
N'-[2-[1-(4,6-dimethylpyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-naphthalen-2-yloxypropanehydrazide (PubChem CID 55581049) has the molecular formula C26H28N6O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is N'-[2-[1-(4,6-dimethylpyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-naphthalen-2-yloxypropanehydrazide.
| Compound Name | N'-[2-[1-(4,6-dimethylpyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-naphthalen-2-yloxypropanehydrazide |
|---|---|
| PubChem CID | 55581049 |
| Molecular Formula | C26H28N6O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N'-[2-[1-(4,6-dimethylpyrimidin-2-yl)-3,5-dimethylpyrazol-4-yl]acetyl]-2-naphthalen-2-yloxypropanehydrazide |
| SMILES | Cc1cc(C)nc(-n2nc(C)c(CC(=O)NNC(=O)C(C)Oc3ccc4ccccc4c3)c2C)n1 |
| InChI | InChI=1S/C26H28N6O3/c1-15-12-16(2)28-26(27-15)32-18(4)23(17(3)31-32)14-24(33)29-30-25(34)19(5)35-22-11-10-20-8-6-7-9-21(20)13-22/h6-13,19H,14H2,1-5H3,(H,29,33)(H,30,34) |
| InChIKey | PNUPBCIMBBDJHJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|