C20H20N2O4S — CID 55581266
1-(1,3-benzodioxol-5-yl)-5-oxo-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 55581266) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-5-oxo-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-5-oxo-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55581266 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-5-oxo-N-prop-2-enyl-N-(thiophen-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | C=CCN(Cc1cccs1)C(=O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C20H20N2O4S/c1-2-7-21(12-16-4-3-8-27-16)20(24)14-9-19(23)22(11-14)15-5-6-17-18(10-15)26-13-25-17/h2-6,8,10,14H,1,7,9,11-13H2 |
| InChIKey | YQQJXNMTOURFKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|