C14H19N3O4S — CID 55587045
(2,5-dimethylmorpholin-4-yl)-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone (PubChem CID 55587045) has the molecular formula C14H19N3O4S and a molecular weight of 325.39 g/mol. Its IUPAC name is (2,5-dimethylmorpholin-4-yl)-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone.
| Compound Name | (2,5-dimethylmorpholin-4-yl)-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone |
|---|---|
| PubChem CID | 55587045 |
| Molecular Formula | C14H19N3O4S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (2,5-dimethylmorpholin-4-yl)-(2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazin-7-yl)methanone |
| SMILES | CC1CN(C(=O)C2=CN3CCS(=O)(=O)N=C3C=C2)C(C)CO1 |
| InChI | InChI=1S/C14H19N3O4S/c1-10-9-21-11(2)7-17(10)14(18)12-3-4-13-15-22(19,20)6-5-16(13)8-12/h3-4,8,10-11H,5-7,9H2,1-2H3 |
| InChIKey | SBXNNCGQSWLNCJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 79.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |