C21H22ClNO — CID 55588882
2-(2-chlorophenyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]cyclopropane-1-carboxamide (PubChem CID 55588882) has the molecular formula C21H22ClNO and a molecular weight of 339.87 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]cyclopropane-1-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 55588882 |
| Molecular Formula | C21H22ClNO |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-(2-chlorophenyl)-N-cyclopropyl-N-[(4-methylphenyl)methyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(CN(C(=O)C2CC2c2ccccc2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C21H22ClNO/c1-14-6-8-15(9-7-14)13-23(16-10-11-16)21(24)19-12-18(19)17-4-2-3-5-20(17)22/h2-9,16,18-19H,10-13H2,1H3 |
| InChIKey | IADJMHIFEOXMSR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |