C21H22ClNO3 — CID 55513092
methyl 3-[benzyl-[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]propanoate (PubChem CID 55513092) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is methyl 3-[benzyl-[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]propanoate.
| Compound Name | methyl 3-[benzyl-[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55513092 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | methyl 3-[benzyl-[2-(2-chlorophenyl)cyclopropanecarbonyl]amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)C1CC1c1ccccc1Cl |
| InChI | InChI=1S/C21H22ClNO3/c1-26-20(24)11-12-23(14-15-7-3-2-4-8-15)21(25)18-13-17(18)16-9-5-6-10-19(16)22/h2-10,17-18H,11-14H2,1H3 |
| InChIKey | JETOYDHSDPGSEC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |