C18H18BrFN2O3 — CID 55593776
N-[(5-bromo-2-fluorophenyl)methyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide (PubChem CID 55593776) has the molecular formula C18H18BrFN2O3 and a molecular weight of 409.26 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55593776 |
| Molecular Formula | C18H18BrFN2O3 |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-1-(furan-2-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1cc(Br)ccc1F)C1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H18BrFN2O3/c19-14-3-4-15(20)13(10-14)11-21-17(23)12-5-7-22(8-6-12)18(24)16-2-1-9-25-16/h1-4,9-10,12H,5-8,11H2,(H,21,23) |
| InChIKey | ZMYMCFJKYUZYPM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |