C21H24BrFN2O3S — CID 55594121
N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide (PubChem CID 55594121) has the molecular formula C21H24BrFN2O3S and a molecular weight of 483.40 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55594121 |
| Molecular Formula | C21H24BrFN2O3S |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-3-(4-piperidin-1-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C21H24BrFN2O3S/c22-18-7-10-20(23)17(14-18)15-24-21(26)11-6-16-4-8-19(9-5-16)29(27,28)25-12-2-1-3-13-25/h4-5,7-10,14H,1-3,6,11-13,15H2,(H,24,26) |
| InChIKey | PEYBHGDZVVCBDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |