C22H26ClFN2O3S — CID 55594889
N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-3-(diethylsulfamoyl)-4-fluorobenzamide (PubChem CID 55594889) has the molecular formula C22H26ClFN2O3S and a molecular weight of 452.98 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-3-(diethylsulfamoyl)-4-fluorobenzamide.
| Compound Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-3-(diethylsulfamoyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 55594889 |
| Molecular Formula | C22H26ClFN2O3S |
| Molecular Weight | 452.98 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[1-(4-chlorophenyl)ethyl]-N-cyclopropyl-3-(diethylsulfamoyl)-4-fluorobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)N(C2CC2)C(C)c2ccc(Cl)cc2)ccc1F |
| InChI | InChI=1S/C22H26ClFN2O3S/c1-4-25(5-2)30(28,29)21-14-17(8-13-20(21)24)22(27)26(19-11-12-19)15(3)16-6-9-18(23)10-7-16/h6-10,13-15,19H,4-5,11-12H2,1-3H3 |
| InChIKey | BYSCHGIFBRVSCV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.98 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |