C23H21FN2O5 — CID 55595695
[2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxylate (PubChem CID 55595695) has the molecular formula C23H21FN2O5 and a molecular weight of 424.43 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxylate.
| Compound Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 55595695 |
| Molecular Formula | C23H21FN2O5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | [2-methoxy-4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl] 5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxylate |
| SMILES | CCc1c(C(=O)Oc2ccc(/C=C/C(=O)OC)cc2OC)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C23H21FN2O5/c1-4-19-18(14-25-26(19)17-9-7-16(24)8-10-17)23(28)31-20-11-5-15(13-21(20)29-2)6-12-22(27)30-3/h5-14H,4H2,1-3H3/b12-6+ |
| InChIKey | FVOBPQPZTOWVOI-WUXMJOGZSA-N |
| XLogP | 3.99 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|