C22H20FN5O2 — CID 56552513
5-ethyl-1-(4-fluorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]pyrazole-4-carboxamide (PubChem CID 56552513) has the molecular formula C22H20FN5O2 and a molecular weight of 405.43 g/mol. Its IUPAC name is 5-ethyl-1-(4-fluorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-1-(4-fluorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 56552513 |
| Molecular Formula | C22H20FN5O2 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 5-ethyl-1-(4-fluorophenyl)-N-[5-(2-methoxyphenyl)-1H-pyrazol-3-yl]pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)Nc2cc(-c3ccccc3OC)[nH]n2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FN5O2/c1-3-19-17(13-24-28(19)15-10-8-14(23)9-11-15)22(29)25-21-12-18(26-27-21)16-6-4-5-7-20(16)30-2/h4-13H,3H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | LBQLNRZZHCLQJE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |