C22H27N5O4S — CID 55597814
1-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea (PubChem CID 55597814) has the molecular formula C22H27N5O4S and a molecular weight of 457.56 g/mol. Its IUPAC name is 1-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea.
| Compound Name | 1-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea |
|---|---|
| PubChem CID | 55597814 |
| Molecular Formula | C22H27N5O4S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-3-[2-[(4-methylphenyl)sulfonylamino]ethyl]urea |
| SMILES | COc1ccccc1C(NC(=O)NCCNS(=O)(=O)c1ccc(C)cc1)c1nccn1C |
| InChI | InChI=1S/C22H27N5O4S/c1-16-8-10-17(11-9-16)32(29,30)25-13-12-24-22(28)26-20(21-23-14-15-27(21)2)18-6-4-5-7-19(18)31-3/h4-11,14-15,20,25H,12-13H2,1-3H3,(H2,24,26,28) |
| InChIKey | CVXFCKXNBWENBB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|