C22H29N3O3 — CID 55597997
[4-(6-tert-butyl-1H-indole-2-carbonyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 55597997) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is [4-(6-tert-butyl-1H-indole-2-carbonyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(6-tert-butyl-1H-indole-2-carbonyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 55597997 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | [4-(6-tert-butyl-1H-indole-2-carbonyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | CC(C)(C)c1ccc2cc(C(=O)N3CCN(C(=O)C4CCCO4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)16-7-6-15-13-18(23-17(15)14-16)20(26)24-8-10-25(11-9-24)21(27)19-5-4-12-28-19/h6-7,13-14,19,23H,4-5,8-12H2,1-3H3 |
| InChIKey | RHRDRQVWWGZFEL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |