C23H28N4O — CID 55597469
(6-tert-butyl-1H-indol-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 55597469) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is (6-tert-butyl-1H-indol-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (6-tert-butyl-1H-indol-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55597469 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (6-tert-butyl-1H-indol-2-yl)-[4-(pyridin-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | CC(C)(C)c1ccc2cc(C(=O)N3CCN(Cc4cccnc4)CC3)[nH]c2c1 |
| InChI | InChI=1S/C23H28N4O/c1-23(2,3)19-7-6-18-13-21(25-20(18)14-19)22(28)27-11-9-26(10-12-27)16-17-5-4-8-24-15-17/h4-8,13-15,25H,9-12,16H2,1-3H3 |
| InChIKey | PSZFNCLSVFVYNU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |