C13H26N4O3S — CID 55599014
4-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-3-methylbutan-2-yl]morpholine (PubChem CID 55599014) has the molecular formula C13H26N4O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-3-methylbutan-2-yl]morpholine.
| Compound Name | 4-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-3-methylbutan-2-yl]morpholine |
|---|---|
| PubChem CID | 55599014 |
| Molecular Formula | C13H26N4O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[1-[[2-cyanoethyl(methyl)sulfamoyl]amino]-3-methylbutan-2-yl]morpholine |
| SMILES | CC(C)C(CNS(=O)(=O)N(C)CCC#N)N1CCOCC1 |
| InChI | InChI=1S/C13H26N4O3S/c1-12(2)13(17-7-9-20-10-8-17)11-15-21(18,19)16(3)6-4-5-14/h12-13,15H,4,6-11H2,1-3H3 |
| InChIKey | VAXQBGVRXSFRSB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |