C13H28N2O3S — CID 95974504
(2R)-N-[(2R)-3-methyl-2-morpholin-4-ylbutyl]butane-2-sulfonamide (PubChem CID 95974504) has the molecular formula C13H28N2O3S and a molecular weight of 292.44 g/mol. Its IUPAC name is (2R)-N-[(2R)-3-methyl-2-morpholin-4-ylbutyl]butane-2-sulfonamide.
| Compound Name | (2R)-N-[(2R)-3-methyl-2-morpholin-4-ylbutyl]butane-2-sulfonamide |
|---|---|
| PubChem CID | 95974504 |
| Molecular Formula | C13H28N2O3S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | (2R)-N-[(2R)-3-methyl-2-morpholin-4-ylbutyl]butane-2-sulfonamide |
| SMILES | CC[C@@H](C)S(=O)(=O)NC[C@@H](C(C)C)N1CCOCC1 |
| InChI | InChI=1S/C13H28N2O3S/c1-5-12(4)19(16,17)14-10-13(11(2)3)15-6-8-18-9-7-15/h11-14H,5-10H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | IVDFSWBTYKVNMB-OLZOCXBDSA-N |
| XLogP | 1.06 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |