C16H19Cl2N3O3S — CID 55600497
4,5-dichloro-N-[4-(diethylsulfamoyl)phenyl]-1-methylpyrrole-2-carboxamide (PubChem CID 55600497) has the molecular formula C16H19Cl2N3O3S and a molecular weight of 404.32 g/mol. Its IUPAC name is 4,5-dichloro-N-[4-(diethylsulfamoyl)phenyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-[4-(diethylsulfamoyl)phenyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 55600497 |
| Molecular Formula | C16H19Cl2N3O3S |
| Molecular Weight | 404.32 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | 4,5-dichloro-N-[4-(diethylsulfamoyl)phenyl]-1-methylpyrrole-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)c2cc(Cl)c(Cl)n2C)cc1 |
| InChI | InChI=1S/C16H19Cl2N3O3S/c1-4-21(5-2)25(23,24)12-8-6-11(7-9-12)19-16(22)14-10-13(17)15(18)20(14)3/h6-10H,4-5H2,1-3H3,(H,19,22) |
| InChIKey | JSNCLOIFSARMPV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |