C19H25FN2O5S — CID 55601624
[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 4-fluoro-3-(prop-2-enylsulfamoyl)benzoate (PubChem CID 55601624) has the molecular formula C19H25FN2O5S and a molecular weight of 412.48 g/mol. Its IUPAC name is [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 4-fluoro-3-(prop-2-enylsulfamoyl)benzoate.
| Compound Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 4-fluoro-3-(prop-2-enylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 55601624 |
| Molecular Formula | C19H25FN2O5S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl] 4-fluoro-3-(prop-2-enylsulfamoyl)benzoate |
| SMILES | C=CCNS(=O)(=O)c1cc(C(=O)OCC(=O)N2CC(C)CC(C)C2)ccc1F |
| InChI | InChI=1S/C19H25FN2O5S/c1-4-7-21-28(25,26)17-9-15(5-6-16(17)20)19(24)27-12-18(23)22-10-13(2)8-14(3)11-22/h4-6,9,13-14,21H,1,7-8,10-12H2,2-3H3 |
| InChIKey | SSGOVXOCVAQGDE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|