C17H19N3O3S2 — CID 55603402
2-[cyclopropyl(pyridin-3-ylsulfonyl)amino]-N-(4-methylsulfanylphenyl)acetamide (PubChem CID 55603402) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[cyclopropyl(pyridin-3-ylsulfonyl)amino]-N-(4-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[cyclopropyl(pyridin-3-ylsulfonyl)amino]-N-(4-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 55603402 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[cyclopropyl(pyridin-3-ylsulfonyl)amino]-N-(4-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccc(NC(=O)CN(C2CC2)S(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-24-15-8-4-13(5-9-15)19-17(21)12-20(14-6-7-14)25(22,23)16-3-2-10-18-11-16/h2-5,8-11,14H,6-7,12H2,1H3,(H,19,21) |
| InChIKey | NECKKOHCBGGEOQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |